OUP-16
|
|
| Names
|
| IUPAC name
1-cyano-3-[[(2R,5R)-5-(1H-imidazol-5-yl)oxolan-2-yl]methyl]-2-methylguanidine
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
InChI=1S/C11H16N6O/c1-13-11(16-6-12)15-4-8-2-3-10(18-8)9-5-14-7-17-9/h5,7-8,10H,2-4H2,1H3,(H,14,17)(H2,13,15,16)/t8-,10-/m1/s1 Key: CCOQWVUQXNRKKP-PSASIEDQSA-N
|
CN=C(NC[C@H]1CC[C@@H](O1)C2=CN=CN2)NC#N
|
| Properties
|
|
|
C11H16N6O
|
| Molar mass
|
248.290 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
OUP-16 is a histamine agonist selective for the H4 subtype.[1]
References
- ^ Hashimoto, T; Harusawa, S; Araki, L; Zuiderveld, OP; Smit, MJ; Imazu, T; Takashima, S; Yamamoto, Y; Sakamoto, Y; Kurihara, T; Leurs, R; Bakker, RA; Yamatodani, A (July 2003). "A Selective Human H4-Receptor Agonist: (−)-2-Cyano-1-methyl-3-{(2R,5R)-5- [1H-imidazol-4(5)-yl]tetrahydrofuran-2-yl}methylguanidine". Journal of Medicinal Chemistry. 46 (14): 3162–5. doi:10.1021/jm0300025. PMID 12825954.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | |
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|