Niperotidine
|
|
| Names
|
Preferred IUPAC name
(Z)-N1-[(2H-1,3-Benzodioxol-5-yl)methyl]-N′1-{2-[({5-[(dimethylamino)methyl]furan-2-yl}methyl)sulfanyl]ethyl}-2-nitroethene-1,1-diamine
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.076.612
|
| EC Number
|
|
| KEGG
|
|
| MeSH
|
C073716
|
|
|
|
| UNII
|
|
InChI=1S/C20H28N4O5S/c1-23(2)11-16-4-5-17(29-16)13-30-8-7-21-20(12-24(25)26)22-10-15-3-6-18-19(9-15)28-14-27-18/h3-6,9,20-22H,7-8,10-14H2,1-2H3 N Key: VZPXHGJTEAPNAA-UHFFFAOYSA-N N InChI=1/C20H28N4O5S/c1-23(2)11-16-4-5-17(29-16)13-30-8-7-21-20(12-24(25)26)22-10-15-3-6-18-19(9-15)28-14-27-18/h3-6,9,20-22H,7-8,10-14H2,1-2H3 Key: VZPXHGJTEAPNAA-UHFFFAOYAQ
|
CN(C)Cc1ccc(o1)CSCCN/C(=C\[N+](=O)[O-])NCc2cc3OCOc3cc2
|
| Properties
|
|
|
C20H26N4O5S
|
| Molar mass
|
434.51 g·mol−1
|
| Pharmacology
|
|
|
A02BA05 (WHO)
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Niperotidine is a histamine antagonist selective for the H2 subtype. It was studied as a treatment for excessive gastric acidity,[1] but withdrawn after human trials showed liver damage.[2]
References
- ^ Palasciano, G; Maggi, V; Portincasa, P (1990). "The effect of the H2-antagonist niperotidine on intragastric acidity in healthy subjects undergoing 24-hour pH-monitoring". The Italian Journal of Gastroenterology. 22 (5): 291–4. PMID 1983712.
- ^ Gasbarrini, G; Gentiloni, N; Febbraro, S; Gasbarrini, A; Di Campli, C; Cesana, M; Miglio, F; Miglioli, M; Ghinelli, F; d'Ambrosi, A; Amoroso, P; Pacini, F; Salvadori, G (1997). "Acute liver injury related to the use of niperotidine". Journal of Hepatology. 27 (3): 583–6. doi:10.1016/s0168-8278(97)80365-0. PMID 9314138.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | |
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|