Terflavin B
|
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
|
|
|
InChI=1S/C34H24O22/c35-9-1-6(2-10(36)19(9)39)30(47)52-5-13-27(25(45)26(46)34(51)53-13)54-31(48)7-3-11(37)20(40)22(42)14(7)16-18-17-15-8(32(49)55-29(17)24(44)23(16)43)4-12(38)21(41)28(15)56-33(18)50/h1-4,13,25-27,34-46,51H,5H2/t13-,25-,26-,27-,34?/m1/s1 Key: UKIPVDAOZKIZJT-RPMOVZCCSA-N
|
C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O
|
| Properties
|
|
|
C34H24O22
|
| Molar mass
|
784.54 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Terflavin B is an ellagitannin, a type of hydrolysable tannin. It can be found in Myrobalanus chebula (Terminalia chebula), the black chebulic, and in Terminalia catappa, the Indian almond.[1]
It is formed from a nonahydroxytriphenic acid dilactone and a gallic acid linked to a glucose molecules.
References
|
|---|
| Moieties | |
|---|
| Lactones | |
|---|
| Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and
- Tergallic acid
- Tergallic acid dilactone
| C-glycosidic ellagitannins | |
|---|
Dehydroellagitannins (molecules with dehydrohexahydroxydiphenic acid (DHHDP) | |
|---|
| Transformed ellagitannins | | molecules with chebulic acid | |
|---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
|---|
|
|---|
|
|---|
| Oligomers | |
|---|
| Other | |
|---|