PF-514273 |
|
2-(2-chlorophenyl)-3-(4-chlorophenyl)-7-(2,2-difluoropropyl)-6,7-dihydro-2H-pyrazolo[3,4-f][1,4]oxazepin-8(5H)-one
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| CompTox Dashboard (EPA) | |
|---|
|
| Formula | C21H17Cl2F2N3O2 |
|---|
| Molar mass | 452.28 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
O=C1N(CC(F)(C)F)CCOc2c1nn(c2-c(cc4)ccc4Cl)-c3ccccc3Cl
|
InChI=1S/C21H17Cl2F2N3O2/c1-21(24,25)12-27-10-11-30-19-17(20(27)29)26-28(16-5-3-2-4-15(16)23)18(19)13-6-8-14(22)9-7-13/h2-9H,10-12H2,1H3 Key:FJMQJSUOOGOWBD-UHFFFAOYSA-N
|
| NY (what is this?) |
PF-514273 is a drug developed by Pfizer, which acts as an extremely selective antagonist for the CB1 receptor, with approximately 10,000x selectivity over the closely related CB2 receptor. This very high selectivity makes it useful for scientific research into these receptors, as many commonly used cannabinoid receptor antagonists also block the CB2 receptor to some extent.[1]
References
- ^ Dow RL, Carpino PA, Hadcock JR, Black SC, Iredale PA, DaSilva-Jardine P, et al. (May 2009). "Discovery of 2-(2-chlorophenyl)-3-(4-chlorophenyl)-7-(2,2-difluoropropyl)-6,7-dihydro-2H-pyrazolo[3,4-f][1,4]oxazepin-8(5H)-one (PF-514273), a novel, bicyclic lactam-based cannabinoid-1 receptor antagonist for the treatment of obesity". Journal of Medicinal Chemistry. 52 (9): 2652–5. doi:10.1021/jm900255t. PMID 19351113.
|
|---|
Phytocannabinoids (comparison) | | Cannabibutols | |
|---|
| Cannabichromenes | |
|---|
| Cannabicyclols | |
|---|
| Cannabidiols | |
|---|
| Cannabielsoins | |
|---|
| Cannabigerols | |
|---|
| Cannabiphorols | |
|---|
| Cannabinols |
- CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
|---|
| Cannabitriols | |
|---|
| Cannabivarins | |
|---|
| Delta-3-tetrahydrocannabinols | |
|---|
| Delta-4-tetrahydrocannabinols | |
|---|
| Delta-7-tetrahydrocannabinols | |
|---|
| Delta-8-tetrahydrocannabinols | |
|---|
| Delta-9-tetrahydrocannabinols | |
|---|
| Delta-10-Tetrahydrocannabinols | |
|---|
| Delta-11-Tetrahydrocannabinols | |
|---|
| Miscellaneous cannabinoids | |
|---|
| Active metabolites | |
|---|
|
|---|
| Endocannabinoids | |
|---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
Non-classical cannabinoids | |
|---|
| Adamantoylindoles | |
|---|
| Benzimidazoles | |
|---|
| Benzoylindoles | |
|---|
| Cyclohexylphenols | |
|---|
| Eicosanoids | |
|---|
Indazole-3- carboxamides | |
|---|
| Indole-3-carboxamides | |
|---|
| Indole-3-carboxylates | |
|---|
| Naphthoylindazoles | |
|---|
| Naphthoylindoles | |
|---|
| Naphthoylpyrroles | |
|---|
| Naphthylmethylindenes | |
|---|
| Naphthylmethylindoles | |
|---|
| Phenylacetylindoles | |
|---|
| Pyrazolecarboxamides | |
|---|
Tetramethylcyclo- propanoylindazoles | |
|---|
Tetramethylcyclo- propanoylindoles | |
|---|
| Others | |
|---|
|
|---|
| Allosteric CBRTooltip Cannabinoid receptor ligands | |
|---|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|