Oudenone
|
|
|
|
| Names
|
Preferred IUPAC name
2-[(5S)-5-Propyloxolan-2-ylidene]cyclopentane-1,3-dione
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C12H16O3/c1-2-3-8-4-7-11(15-8)12-9(13)5-6-10(12)14/h8H,2-7H2,1H3/t8-/m0/s1 Y Key: AFHDYMGMZUYZQT-QMMMGPOBSA-N Y InChI=1/C12H16O3/c1-2-3-8-4-7-11(15-8)12-9(13)5-6-10(12)14/h8H,2-7H2,1H3/t8-/m0/s1 Key: AFHDYMGMZUYZQT-QMMMGPOBBE
|
O=C1C(/C(=O)CC1)=C2/O[C@H](CC2)CCC
|
| Properties
|
|
|
C12H16O3
|
| Molar mass
|
208.25 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Oudenone is a molecule found in fungus metabolism.[1] It is an inhibitor of the enzyme tyrosine hydroxylase.
References
- ^ Tsantrizos YS, Yang X, McClory A (September 1999). "Studies on the Biosynthesis of the Fungal Metabolite Oudenone. 2. Synthesis and Enzymatic Cyclization of an alpha-Diketone, Open-Chain Precursor into Oudenone in Cultures of Oudemansiella radicata". J. Org. Chem. 64 (18): 6609–6614. doi:10.1021/jo9901135. PMID 11674663.
|
|---|
| Non-specific | | AAADTooltip Aromatic L-amino acid decarboxylase | |
|---|
| MAOTooltip Monoamine oxidase | |
|---|
|
|---|
Phenethylamines (dopamine, epinephrine, norepinephrine) | | PAHTooltip Phenylalanine hydroxylase | |
|---|
| THTooltip Tyrosine hydroxylase | |
|---|
| DBHTooltip Dopamine beta-hydroxylase | |
|---|
| PNMTTooltip Phenylethanolamine N-methyltransferase |
- Inhibitors: CGS-19281A
- SKF-64139
- SKF-7698
|
|---|
| COMTTooltip Catechol-O-methyl transferase | |
|---|
|
|---|
Tryptamines (serotonin, melatonin) | | TPHTooltip Tryptophan hydroxylase | |
|---|
| AANATTooltip Serotonin N-acetyl transferase | |
|---|
| ASMTTooltip Acetylserotonin O-methyltransferase | |
|---|
|
|---|
| Histamine | | HDCTooltip Histidine decarboxylase | |
|---|
| HNMTTooltip Histamine N-methyltransferase |
- Substrates→Products: Histamine→N-Methylhistamine
|
|---|
| DAOTooltip Diamine oxidase |
- Substrates→Products: Histamine→Imidazole acetic acid
|
|---|
|
|---|
See also: Receptor/signaling modulators • Adrenergics • Dopaminergics • Melatonergics • Serotonergics • Monoamine reuptake inhibitors • Monoamine releasing agents • Monoamine neurotoxins |