Flexuosol A
|
|
| Names
|
Preferred IUPAC name
5-[(2R,3R)-4-{(2S,3S,5R,6R)-5-(3,5-Dihydroxyphenyl)-2,6-bis(4-hydroxyphenyl)-4-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]-2,3,5,6-tetrahydro(benzo[1,2-b:5,4-b′]difuran)-3-yl}-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C56H42O11/c57-35-13-4-29(5-14-35)6-21-44-51-46(66-55(31-9-17-37(59)18-10-31)49(51)34-24-41(63)27-42(64)25-34)28-47-52(44)53(56(67-47)32-11-19-38(60)20-12-32)43-2-1-3-45-50(43)48(33-22-39(61)26-40(62)23-33)54(65-45)30-7-15-36(58)16-8-30/h1-28,48-49,53-64H/b21-6+/t48-,49-,53+,54+,55+,56-/m1/s1 Key: AZTITUGYPXKUCV-CGOOCLRTSA-N
|
OC1=CC([C@H]2[C@H](C3=CC=C(O)C=C3)OC4=CC5=C([C@@](C6=CC=CC7=C6[C@@H](C8=CC(O)=CC(O)=C8)[C@H](C9=CC=C(O)C=C9)O7)([H])[C@@H](C%10=CC=C(O)C=C%10)O5)C(/C=C/C%11=CC=C(O)C=C%11)=C42)=CC(O)=C1
|
| Properties
|
|
|
C56H42O12
|
| Molar mass
|
906.940 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Flexuosol A is a resveratrol tetramer found in Vitis flexuosa.[1]
References
- ^ Li, Wen-wu; Li, Bo-Gang; Chen, Yao-zu (1998). "Flexuosol A, a New Tetrastilbene fromVitis flexuosa". Journal of Natural Products. 61 (5): 646–7. doi:10.1021/np970457v. PMID 9599267.
|
|---|
- Diptoindonesin C
- Diptoindonesin F
- Gnetin H
- Hemsleyanol D
- Isohopeaphenol
- Laetevirenol A, B, C, D and E
- Suffruticosol A and B
- Viniferal
- E-ω-viniferin
- Z-ω-viniferin
|
| Dimers |
- Diptoindonesin G
- Jezonodione
- B
- Scirpusin A
- Tibeticanol (piceatannol dimer)
|
|---|
| Trimers |
- Amurensin B
- Gnetin E
- Gneyulin A
- Johorenol A
- Ampelopsin E
- Vaticanol G
|
|---|
| Tetramers: |
- Dibalanocarpol
- Gnetin J (3"-hydroxygnetin E)
- Gnetin K (3"-methoxygnetin E)
- Gnetuhainin R (isorhapontigenin tetramer)
- Laetevirenol F and G
|
|---|
Higher polymers (five units or more) | |
|---|
Oligomeric forms of resveratrol | | Dimers | |
|---|
| Trimers | |
|---|
| Tetramers | |
|---|
| Pentamers | |
|---|
| Hexamers | |
|---|
| Higher polymers |
- γ-viniferin
- Valeriaphenol A
|
|---|
|
|---|
| Glycosides or conjugates |
- Diptoindonesin A (C-glucoside of ε-viniferin)
- Foeniculoside I (glucoside of miyabenol C), II, III and IV
- Laevifonol (an ε-viniferin-ascorbic acid hybrid compound)
- Laevifoside (O-glucoside of ampelopsin A)
|
|---|