Clentiazem
|
|
| Names
|
Preferred IUPAC name
(2S,3S)-8-Chloro-5-[2-(dimethylamino)ethyl]-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C22H25ClN2O4S/c1-14(26)29-20-21(15-5-8-17(28-4)9-6-15)30-19-13-16(23)7-10-18(19)25(22(20)27)12-11-24(2)3/h5-10,13,20-21H,11-12H2,1-4H3/t20-,21+/m1/s1 N Key: GYKFWCDBQAFCLJ-RTWAWAEBSA-N N InChI=1/C22H25ClN2O4S/c1-14(26)29-20-21(15-5-8-17(28-4)9-6-15)30-19-13-16(23)7-10-18(19)25(22(20)27)12-11-24(2)3/h5-10,13,20-21H,11-12H2,1-4H3/t20-,21+/m1/s1 Key: GYKFWCDBQAFCLJ-RTWAWAEBBL
|
CC(=O)OC1C(SC2=C(C=CC(=C2)Cl)N(C1=O)CCN(C)C)C3=CC=C(C=C3)OC
|
| Properties
|
|
|
C22H25ClN2O4S
|
| Molar mass
|
448.9629
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Clentiazem is a calcium channel blocker.[1]
It is a chlorine derivative of diltiazem.[2]
References
- ^ Giasson S, Garceau D, Homsy W, Dumont L (October 1995). "Pharmacodynamics and pharmacokinetics of clentiazem and diltiazem in closed-chest anesthetized dogs". Cardiovasc Drugs Ther. 9 (5): 685–92. doi:10.1007/BF00878551. PMID 8573551. S2CID 37503776.
- ^ Dagenais F, Hollmann C, Buluran J, Cartier R (October 1995). "Clentiazem and diltiazem preserve endothelium-dependent relaxation following global rat heart ischemia". Can J Cardiol. 11 (9): 816–22. PMID 7585280.
|
|---|
| Calcium | | VDCCsTooltip Voltage-dependent calcium channels | |
|---|
|
|---|
| Potassium | | VGKCsTooltip Voltage-gated potassium channels | |
|---|
| IRKsTooltip Inwardly rectifying potassium channel | | Blockers | |
|---|
| Activators |
- GIRKTooltip G protein-coupled inwardly rectifying potassium channel-specific: ML-297 (VU0456810)
|
|---|
|
|---|
| KCaTooltip Calcium-activated potassium channel | |
|---|
| K2PsTooltip Tandem pore domain potassium channel | |
|---|
|
|---|
| Sodium | | VGSCsTooltip Voltage-gated sodium channels | |
|---|
| ENaCTooltip Epithelial sodium channel | |
|---|
| ASICsTooltip Acid-sensing ion channel | |
|---|
|
|---|
| Chloride | | CaCCsTooltip Calcium-activated chloride channel | |
|---|
| CFTRTooltip Cystic fibrosis transmembrane conductance regulator | |
|---|
| Unsorted | |
|---|
|
|---|
| Others | | TRPsTooltip Transient receptor potential channels | |
|---|
| LGICsTooltip Ligand gated ion channels | |
|---|
|
|---|
See also: Receptor/signaling modulators • Transient receptor potential channel modulators |